C18H25NO — CID 130343870
(E)-4-[benzyl(4,4-dimethylpent-1-en-2-yl)amino]but-3-en-2-one (PubChem CID 130343870) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (E)-4-[benzyl(4,4-dimethylpent-1-en-2-yl)amino]but-3-en-2-one.
| Compound Name | (E)-4-[benzyl(4,4-dimethylpent-1-en-2-yl)amino]but-3-en-2-one |
|---|---|
| PubChem CID | 130343870 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (E)-4-[benzyl(4,4-dimethylpent-1-en-2-yl)amino]but-3-en-2-one |
| SMILES | C=C(CC(C)(C)C)N(/C=C/C(C)=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO/c1-15(13-18(3,4)5)19(12-11-16(2)20)14-17-9-7-6-8-10-17/h6-12H,1,13-14H2,2-5H3/b12-11+ |
| InChIKey | ZOOHNAHYLLBUAI-VAWYXSNFSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|