C20H21NO — CID 89172718
N-benzyl-N-[(1Z)-3-methyl-1-phenylbuta-1,3-dien-2-yl]acetamide (PubChem CID 89172718) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is N-benzyl-N-[(1Z)-3-methyl-1-phenylbuta-1,3-dien-2-yl]acetamide.
| Compound Name | N-benzyl-N-[(1Z)-3-methyl-1-phenylbuta-1,3-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 89172718 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-benzyl-N-[(1Z)-3-methyl-1-phenylbuta-1,3-dien-2-yl]acetamide |
| SMILES | C=C(C)/C(=C/c1ccccc1)N(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C20H21NO/c1-16(2)20(14-18-10-6-4-7-11-18)21(17(3)22)15-19-12-8-5-9-13-19/h4-14H,1,15H2,2-3H3/b20-14- |
| InChIKey | LGNRBPHZYBKAQY-ZHZULCJRSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|