C16H18FN5 — CID 130344110
(3E,5E)-2-(5-cyclopropyl-1-methylpyrazolo[3,4-b]pyrazin-3-yl)-5-fluorohepta-1,3,5-trien-4-amine (PubChem CID 130344110) has the molecular formula C16H18FN5 and a molecular weight of 299.35 g/mol. Its IUPAC name is (3E,5E)-2-(5-cyclopropyl-1-methylpyrazolo[3,4-b]pyrazin-3-yl)-5-fluorohepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-2-(5-cyclopropyl-1-methylpyrazolo[3,4-b]pyrazin-3-yl)-5-fluorohepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 130344110 |
| Molecular Formula | C16H18FN5 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (3E,5E)-2-(5-cyclopropyl-1-methylpyrazolo[3,4-b]pyrazin-3-yl)-5-fluorohepta-1,3,5-trien-4-amine |
| SMILES | C=C(/C=C(N)\C(F)=C/C)c1nn(C)c2ncc(C3CC3)nc12 |
| InChI | InChI=1S/C16H18FN5/c1-4-11(17)12(18)7-9(2)14-15-16(22(3)21-14)19-8-13(20-15)10-5-6-10/h4,7-8,10H,2,5-6,18H2,1,3H3/b11-4+,12-7+ |
| InChIKey | OJYCDGOSRNGRRT-WJMKSPIQSA-N |
| XLogP | 2.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|