C16H17N3O4S3 — CID 130344862
[5-[3-(1-methylpyrazol-4-yl)-5-methylsulfonylphenyl]sulfonylthiophen-2-yl]methanamine (PubChem CID 130344862) has the molecular formula C16H17N3O4S3 and a molecular weight of 411.53 g/mol. Its IUPAC name is [5-[3-(1-methylpyrazol-4-yl)-5-methylsulfonylphenyl]sulfonylthiophen-2-yl]methanamine.
| Compound Name | [5-[3-(1-methylpyrazol-4-yl)-5-methylsulfonylphenyl]sulfonylthiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 130344862 |
| Molecular Formula | C16H17N3O4S3 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [5-[3-(1-methylpyrazol-4-yl)-5-methylsulfonylphenyl]sulfonylthiophen-2-yl]methanamine |
| SMILES | Cn1cc(-c2cc(S(C)(=O)=O)cc(S(=O)(=O)c3ccc(CN)s3)c2)cn1 |
| InChI | InChI=1S/C16H17N3O4S3/c1-19-10-12(9-18-19)11-5-14(25(2,20)21)7-15(6-11)26(22,23)16-4-3-13(8-17)24-16/h3-7,9-10H,8,17H2,1-2H3 |
| InChIKey | FRVLHLFCOVBQIV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |