C15H15N3O4S3 — CID 130345071
[5-[3-methylsulfonyl-5-(1H-pyrazol-4-yl)phenyl]sulfonylthiophen-2-yl]methanamine (PubChem CID 130345071) has the molecular formula C15H15N3O4S3 and a molecular weight of 397.50 g/mol. Its IUPAC name is [5-[3-methylsulfonyl-5-(1H-pyrazol-4-yl)phenyl]sulfonylthiophen-2-yl]methanamine.
| Compound Name | [5-[3-methylsulfonyl-5-(1H-pyrazol-4-yl)phenyl]sulfonylthiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 130345071 |
| Molecular Formula | C15H15N3O4S3 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | [5-[3-methylsulfonyl-5-(1H-pyrazol-4-yl)phenyl]sulfonylthiophen-2-yl]methanamine |
| SMILES | CS(=O)(=O)c1cc(-c2cn[nH]c2)cc(S(=O)(=O)c2ccc(CN)s2)c1 |
| InChI | InChI=1S/C15H15N3O4S3/c1-24(19,20)13-4-10(11-8-17-18-9-11)5-14(6-13)25(21,22)15-3-2-12(7-16)23-15/h2-6,8-9H,7,16H2,1H3,(H,17,18) |
| InChIKey | MMUCXFDHUJKQEA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |