C20H22N2O2S2 — CID 130345397
[5-(3-tert-butyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine (PubChem CID 130345397) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is [5-(3-tert-butyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine.
| Compound Name | [5-(3-tert-butyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 130345397 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [5-(3-tert-butyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(S(=O)(=O)c2cnc(CN)s2)c1 |
| InChI | InChI=1S/C20H22N2O2S2/c1-20(2,3)16-9-15(14-7-5-4-6-8-14)10-17(11-16)26(23,24)19-13-22-18(12-21)25-19/h4-11,13H,12,21H2,1-3H3 |
| InChIKey | HYCVXHVVBRZYLY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |