C18H18N2O2S2 — CID 130345060
[5-(3-ethyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine (PubChem CID 130345060) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is [5-(3-ethyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine.
| Compound Name | [5-(3-ethyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 130345060 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [5-(3-ethyl-5-phenylphenyl)sulfonyl-1,3-thiazol-2-yl]methanamine |
| SMILES | CCc1cc(-c2ccccc2)cc(S(=O)(=O)c2cnc(CN)s2)c1 |
| InChI | InChI=1S/C18H18N2O2S2/c1-2-13-8-15(14-6-4-3-5-7-14)10-16(9-13)24(21,22)18-12-20-17(11-19)23-18/h3-10,12H,2,11,19H2,1H3 |
| InChIKey | MRABWNRNUTUZGB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |