C19H30O4 — CID 130346661
tert-butyl 2-[3-(3-methyl-5-methylidenecyclohexyl)propanoyloxymethyl]prop-2-enoate (PubChem CID 130346661) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 2-[3-(3-methyl-5-methylidenecyclohexyl)propanoyloxymethyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[3-(3-methyl-5-methylidenecyclohexyl)propanoyloxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 130346661 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl 2-[3-(3-methyl-5-methylidenecyclohexyl)propanoyloxymethyl]prop-2-enoate |
| SMILES | C=C1CC(C)CC(CCC(=O)OCC(=C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H30O4/c1-13-9-14(2)11-16(10-13)7-8-17(20)22-12-15(3)18(21)23-19(4,5)6/h14,16H,1,3,7-12H2,2,4-6H3 |
| InChIKey | UHXFIEUCZGJYLI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|