C10H21O5P — CID 130347215
3-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]butan-2-ol (PubChem CID 130347215) has the molecular formula C10H21O5P and a molecular weight of 252.25 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]butan-2-ol.
| Compound Name | 3-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]butan-2-ol |
|---|---|
| PubChem CID | 130347215 |
| Molecular Formula | C10H21O5P |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]butan-2-ol |
| SMILES | CC(O)C(C)OCP1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C10H21O5P/c1-8(11)9(2)13-7-16(12)14-5-10(3,4)6-15-16/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | SDRZLQKBMXGSPW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|