C29H36N4O8S — CID 130347946
(4R,6S,16E)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carboxamide (PubChem CID 130347946) has the molecular formula C29H36N4O8S and a molecular weight of 600.69 g/mol. Its IUPAC name is (4R,6S,16E)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carboxamide.
| Compound Name | (4R,6S,16E)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 130347946 |
| Molecular Formula | C29H36N4O8S |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | (4R,6S,16E)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H]2CN1C(=O)CNC(=O)OCCC/C=C\c1cccc(c1)CO2)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C29H36N4O8S/c1-2-21-15-29(21,27(36)32-42(38,39)23-10-11-23)31-26(35)24-14-22-17-33(24)25(34)16-30-28(37)40-12-5-3-4-7-19-8-6-9-20(13-19)18-41-22/h2,4,6-9,13,21-24H,1,3,5,10-12,14-18H2,(H,30,37)(H,31,35)(H,32,36)/b7-4-/t21-,22-,24+,29-/m1/s1 |
| InChIKey | QCRGCWKFWOJIMX-CFKQFOPHSA-N |
| XLogP | 1.38 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|