C30H39N3O7 — CID 59287134
cis-(1R,2R)-1-[[(4R,6S,9S,16E)-9-butyl-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid (PubChem CID 59287134) has the molecular formula C30H39N3O7 and a molecular weight of 553.66 g/mol. Its IUPAC name is cis-(1R,2R)-1-[[(4R,6S,9S,16E)-9-butyl-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-1-[[(4R,6S,9S,16E)-9-butyl-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 59287134 |
| Molecular Formula | C30H39N3O7 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | cis-(1R,2R)-1-[[(4R,6S,9S,16E)-9-butyl-8,11-dioxo-3,12-dioxa-7,10-diazatricyclo[16.3.1.14,7]tricosa-1(22),16,18,20-tetraene-6-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylic acid |
| SMILES | C=C[C@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](CCCC)NC(=O)OCCC/C=C/c1cccc(c1)CO2)C(=O)O |
| InChI | InChI=1S/C30H39N3O7/c1-3-5-13-24-27(35)33-18-23(16-25(33)26(34)32-30(28(36)37)17-22(30)4-2)40-19-21-12-9-11-20(15-21)10-7-6-8-14-39-29(38)31-24/h4,7,9-12,15,22-25H,2-3,5-6,8,13-14,16-19H2,1H3,(H,31,38)(H,32,34)(H,36,37)/b10-7+/t22-,23+,24-,25-,30+/m0/s1 |
| InChIKey | JIFJVSKPPKFGOU-IDUZIEQOSA-N |
| XLogP | 3.41 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|