C25H26N6 — CID 130348820
1-[3-amino-4-(N-benzyl-C-methylcarbonimidoyl)phenyl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine (PubChem CID 130348820) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 1-[3-amino-4-(N-benzyl-C-methylcarbonimidoyl)phenyl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-[3-amino-4-(N-benzyl-C-methylcarbonimidoyl)phenyl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 130348820 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-[3-amino-4-(N-benzyl-C-methylcarbonimidoyl)phenyl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
| SMILES | C/C(=N\Cc1ccccc1)c1ccc(-c2nc(C3CCC3)n3ccnc(N)c23)cc1N |
| InChI | InChI=1S/C25H26N6/c1-16(29-15-17-6-3-2-4-7-17)20-11-10-19(14-21(20)26)22-23-24(27)28-12-13-31(23)25(30-22)18-8-5-9-18/h2-4,6-7,10-14,18H,5,8-9,15,26H2,1H3,(H2,27,28)/b29-16+ |
| InChIKey | JFQYCQWVISDSJS-MUFRIFMGSA-N |
| XLogP | 4.84 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|