About 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine
3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 67416927) has the molecular formula C29H26N4O
and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine |
| PubChem CID | 67416927 |
| Molecular Formula | C29H26N4O |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CCC3)nc(-c3cccc(OCc4ccccc4-c4ccccc4)c3)c12 |
| InChI | InChI=1S/C29H26N4O/c30-28-27-26(32-29(21-11-6-12-21)33(27)17-16-31-28)22-13-7-14-24(18-22)34-19-23-10-4-5-15-25(23)20-8-2-1-3-9-20/h1-5,7-10,13-18,21H,6,11-12,19H2,(H2,30,31) |
| InChIKey | FGERXECQSHBIKJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine?
The IUPAC name of 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine (CID 67416927) is 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine.
What is the SMILES notation for 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine?
The canonical SMILES for 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine is Nc1nccn2c(C3CCC3)nc(-c3cccc(OCc4ccccc4-c4ccccc4)c3)c12.
What is the InChIKey of 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine?
The InChIKey is FGERXECQSHBIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26N4O/c30-28-27-26(32-29(21-11-6-12-21)33(27)17-16-31-28)22-13-7-14-24(18-22)34-19-23-10-4-5-15-25(23)20-8-2-1-3-9-20/h1-5,7-10,13-18,21H,6,11-12,19H2,(H2,30,31).
What are the key properties of 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine?
3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine has a molecular weight of 446.55 g/mol, XLogP of 6.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-1-[3-[(2-phenylphenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-8-amine is sourced from PubChem (CID 67416927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).