C28H29N5O — CID 67417957
3-[3-(2,5-dihydropyrrol-1-ylmethyl)cyclobutyl]-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 67417957) has the molecular formula C28H29N5O and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[3-(2,5-dihydropyrrol-1-ylmethyl)cyclobutyl]-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 3-[3-(2,5-dihydropyrrol-1-ylmethyl)cyclobutyl]-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 67417957 |
| Molecular Formula | C28H29N5O |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 3-[3-(2,5-dihydropyrrol-1-ylmethyl)cyclobutyl]-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CC(CN4CC=CC4)C3)nc(-c3cccc(OCc4ccccc4)c3)c12 |
| InChI | InChI=1S/C28H29N5O/c29-27-26-25(22-9-6-10-24(17-22)34-19-20-7-2-1-3-8-20)31-28(33(26)14-11-30-27)23-15-21(16-23)18-32-12-4-5-13-32/h1-11,14,17,21,23H,12-13,15-16,18-19H2,(H2,29,30) |
| InChIKey | PNHAXTHSANJQGW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|