C31H38N6O2 — CID 67417649
4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide (PubChem CID 67417649) has the molecular formula C31H38N6O2 and a molecular weight of 526.69 g/mol. Its IUPAC name is 4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 67417649 |
| Molecular Formula | C31H38N6O2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide |
| SMILES | CN(C)CCCNC(=O)C1CCC(c2nc(-c3cccc(OCc4ccccc4)c3)c3c(N)nccn23)CC1 |
| InChI | InChI=1S/C31H38N6O2/c1-36(2)18-7-16-34-31(38)24-14-12-23(13-15-24)30-35-27(28-29(32)33-17-19-37(28)30)25-10-6-11-26(20-25)39-21-22-8-4-3-5-9-22/h3-6,8-11,17,19-20,23-24H,7,12-16,18,21H2,1-2H3,(H2,32,33)(H,34,38) |
| InChIKey | ROJGIGZEJVQJIJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|