C34H31N5O3 — CID 11376357
2-[[4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione (PubChem CID 11376357) has the molecular formula C34H31N5O3 and a molecular weight of 557.65 g/mol. Its IUPAC name is 2-[[4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11376357 |
| Molecular Formula | C34H31N5O3 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 2-[[4-[8-amino-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione |
| SMILES | Nc1nccn2c(C3CCC(CN4C(=O)c5ccccc5C4=O)CC3)nc(-c3cccc(OCc4ccccc4)c3)c12 |
| InChI | InChI=1S/C34H31N5O3/c35-31-30-29(25-9-6-10-26(19-25)42-21-23-7-2-1-3-8-23)37-32(38(30)18-17-36-31)24-15-13-22(14-16-24)20-39-33(40)27-11-4-5-12-28(27)34(39)41/h1-12,17-19,22,24H,13-16,20-21H2,(H2,35,36) |
| InChIKey | JJBAGCXUSFIYBT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|