C21H27N5O — CID 70992941
3-[3-(aminomethyl)cyclobutyl]-1-(3-butoxyphenyl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 70992941) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[3-(aminomethyl)cyclobutyl]-1-(3-butoxyphenyl)imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 3-[3-(aminomethyl)cyclobutyl]-1-(3-butoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 70992941 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 3-[3-(aminomethyl)cyclobutyl]-1-(3-butoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | CCCCOc1cccc(-c2nc(C3CC(CN)C3)n3ccnc(N)c23)c1 |
| InChI | InChI=1S/C21H27N5O/c1-2-3-9-27-17-6-4-5-15(12-17)18-19-20(23)24-7-8-26(19)21(25-18)16-10-14(11-16)13-22/h4-8,12,14,16H,2-3,9-11,13,22H2,1H3,(H2,23,24) |
| InChIKey | ULSISSIUXZYFJQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|