C27H30N4O5S — CID 59852741
[4-[8-amino-1-[3-(hydroxymethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl 4-methylbenzenesulfonate (PubChem CID 59852741) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is [4-[8-amino-1-[3-(hydroxymethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [4-[8-amino-1-[3-(hydroxymethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59852741 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | [4-[8-amino-1-[3-(hydroxymethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCC(c3nc(-c4cccc(OCO)c4)c4c(N)nccn34)CC2)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-18-5-11-23(12-6-18)37(33,34)36-16-19-7-9-20(10-8-19)27-30-24(25-26(28)29-13-14-31(25)27)21-3-2-4-22(15-21)35-17-32/h2-6,11-15,19-20,32H,7-10,16-17H2,1H3,(H2,28,29) |
| InChIKey | BNLWTBIYAATRIF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|