C26H26ClN3O3 — CID 130351601
[(1S)-1-(1-chloroethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(methylamino)ethoxy]-1H-indol-2-yl]methanone (PubChem CID 130351601) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is [(1S)-1-(1-chloroethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(methylamino)ethoxy]-1H-indol-2-yl]methanone.
| Compound Name | [(1S)-1-(1-chloroethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(methylamino)ethoxy]-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 130351601 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [(1S)-1-(1-chloroethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(methylamino)ethoxy]-1H-indol-2-yl]methanone |
| SMILES | CNCCOc1ccc2[nH]c(C(=O)N3C[C@@H](C(C)Cl)c4c3cc(O)c3ccccc43)cc2c1 |
| InChI | InChI=1S/C26H26ClN3O3/c1-15(27)20-14-30(23-13-24(31)18-5-3-4-6-19(18)25(20)23)26(32)22-12-16-11-17(33-10-9-28-2)7-8-21(16)29-22/h3-8,11-13,15,20,28-29,31H,9-10,14H2,1-2H3/t15?,20-/m0/s1 |
| InChIKey | WXEQJKWKFRNUNG-MBABXSBOSA-N |
| XLogP | 5.00 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|