C41H30N4 — CID 130353502
9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylphenyl]carbazole (PubChem CID 130353502) has the molecular formula C41H30N4 and a molecular weight of 578.72 g/mol. Its IUPAC name is 9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylphenyl]carbazole.
| Compound Name | 9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylphenyl]carbazole |
|---|---|
| PubChem CID | 130353502 |
| Molecular Formula | C41H30N4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylphenyl]carbazole |
| SMILES | Cc1c(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)ccc(-n2c3ccccc3c3ccccc32)c1C |
| InChI | InChI=1S/C41H30N4/c1-27-28(2)36(45-37-19-11-9-17-34(37)35-18-10-12-20-38(35)45)26-25-33(27)29-21-23-32(24-22-29)41-43-39(30-13-5-3-6-14-30)42-40(44-41)31-15-7-4-8-16-31/h3-26H,1-2H3 |
| InChIKey | IHCJEOQZXCBULX-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |