C64H62N8 — CID 130353539
5,12-bis[2,3,5,6-tetramethyl-4-[4-(2,3,5,6-tetramethylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole (PubChem CID 130353539) has the molecular formula C64H62N8 and a molecular weight of 943.26 g/mol. Its IUPAC name is 5,12-bis[2,3,5,6-tetramethyl-4-[4-(2,3,5,6-tetramethylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole.
| Compound Name | 5,12-bis[2,3,5,6-tetramethyl-4-[4-(2,3,5,6-tetramethylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 130353539 |
| Molecular Formula | C64H62N8 |
| Molecular Weight | 943.26 g/mol |
| Exact Mass | 942.51 |
| IUPAC Name | 5,12-bis[2,3,5,6-tetramethyl-4-[4-(2,3,5,6-tetramethylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole |
| SMILES | Cc1cc(C)c(C)c(-c2ncnc(-c3c(C)c(C)c(-n4c5ccccc5c5c4ccc4c6ccccc6n(-c6c(C)c(C)c(-c7ncnc(-c8c(C)c(C)cc(C)c8C)n7)c(C)c6C)c45)c(C)c3C)n2)c1C |
| InChI | InChI=1S/C64H62N8/c1-31-27-32(2)36(6)53(35(31)5)61-65-29-67-63(69-61)55-39(9)43(13)58(44(14)40(55)10)71-51-24-20-18-22-49(51)57-52(71)26-25-48-47-21-17-19-23-50(47)72(60(48)57)59-45(15)41(11)56(42(12)46(59)16)64-68-30-66-62(70-64)54-37(7)33(3)28-34(4)38(54)8/h17-30H,1-16H3 |
| InChIKey | DEQRELHMJWMXLG-UHFFFAOYSA-N |
| XLogP | 15.85 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.26 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |