C40H36N4S — CID 130354747
9-[2,6-dimethyl-4-(4-methylsulfanyl-1,3,5-triazin-2-yl)phenyl]-3-phenyl-6-(2,3,5,6-tetramethylphenyl)carbazole (PubChem CID 130354747) has the molecular formula C40H36N4S and a molecular weight of 604.82 g/mol. Its IUPAC name is 9-[2,6-dimethyl-4-(4-methylsulfanyl-1,3,5-triazin-2-yl)phenyl]-3-phenyl-6-(2,3,5,6-tetramethylphenyl)carbazole.
| Compound Name | 9-[2,6-dimethyl-4-(4-methylsulfanyl-1,3,5-triazin-2-yl)phenyl]-3-phenyl-6-(2,3,5,6-tetramethylphenyl)carbazole |
|---|---|
| PubChem CID | 130354747 |
| Molecular Formula | C40H36N4S |
| Molecular Weight | 604.82 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 9-[2,6-dimethyl-4-(4-methylsulfanyl-1,3,5-triazin-2-yl)phenyl]-3-phenyl-6-(2,3,5,6-tetramethylphenyl)carbazole |
| SMILES | CSc1ncnc(-c2cc(C)c(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5c(C)c(C)cc(C)c5C)ccc43)c(C)c2)n1 |
| InChI | InChI=1S/C40H36N4S/c1-23-17-24(2)28(6)37(27(23)5)31-14-16-36-34(21-31)33-20-30(29-11-9-8-10-12-29)13-15-35(33)44(36)38-25(3)18-32(19-26(38)4)39-41-22-42-40(43-39)45-7/h8-22H,1-7H3 |
| InChIKey | KXFBXCPKZZAKRM-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.82 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |