C61H62N4 — CID 153304504
9-[4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-2,6-dimethylphenyl]-3,6-bis(2,3,5,6-tetramethylphenyl)carbazole (PubChem CID 153304504) has the molecular formula C61H62N4 and a molecular weight of 851.19 g/mol. Its IUPAC name is 9-[4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-2,6-dimethylphenyl]-3,6-bis(2,3,5,6-tetramethylphenyl)carbazole.
| Compound Name | 9-[4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-2,6-dimethylphenyl]-3,6-bis(2,3,5,6-tetramethylphenyl)carbazole |
|---|---|
| PubChem CID | 153304504 |
| Molecular Formula | C61H62N4 |
| Molecular Weight | 851.19 g/mol |
| Exact Mass | 850.50 |
| IUPAC Name | 9-[4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-2,6-dimethylphenyl]-3,6-bis(2,3,5,6-tetramethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2nc(-c3cc(C)c(-n4c5ccc(-c6c(C)c(C)cc(C)c6C)cc5c5cc(-c6c(C)c(C)cc(C)c6C)ccc54)c(C)c3)nc(-c3c(C)cc(C)cc3C)n2)c(C)c1 |
| InChI | InChI=1S/C61H62N4/c1-31-21-37(7)54(38(8)22-31)60-62-59(63-61(64-60)55-39(9)23-32(2)24-40(55)10)49-27-41(11)58(42(12)28-49)65-52-19-17-47(56-43(13)33(3)25-34(4)44(56)14)29-50(52)51-30-48(18-20-53(51)65)57-45(15)35(5)26-36(6)46(57)16/h17-30H,1-16H3 |
| InChIKey | OCFWUGKSBGFQNG-UHFFFAOYSA-N |
| XLogP | 16.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.19 |
| LogP ≤ 5 | 16.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |