C51H42N4 — CID 146179587
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,6-bis(2,4,6-trimethylphenyl)carbazole (PubChem CID 146179587) has the molecular formula C51H42N4 and a molecular weight of 710.93 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,6-bis(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,6-bis(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 146179587 |
| Molecular Formula | C51H42N4 |
| Molecular Weight | 710.93 g/mol |
| Exact Mass | 710.34 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,6-bis(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccc(-c4c(C)cc(C)cc4C)cc2n3-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(C)c1 |
| InChI | InChI=1S/C51H42N4/c1-31-24-33(3)47(34(4)25-31)39-21-23-45-44(29-39)43-22-20-40(48-35(5)26-32(2)27-36(48)6)30-46(43)55(45)42-19-13-18-41(28-42)51-53-49(37-14-9-7-10-15-37)52-50(54-51)38-16-11-8-12-17-38/h7-30H,1-6H3 |
| InChIKey | MFLUBCJWMLQIBY-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.93 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |