C42H37N9 — CID 130354701
N,N-bis(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)naphthalen-2-amine (PubChem CID 130354701) has the molecular formula C42H37N9 and a molecular weight of 667.82 g/mol. Its IUPAC name is N,N-bis(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)naphthalen-2-amine.
| Compound Name | N,N-bis(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 130354701 |
| Molecular Formula | C42H37N9 |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.32 |
| IUPAC Name | N,N-bis(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)naphthalen-2-amine |
| SMILES | Cc1c(C)c(N(c2ccc3ccccc3c2)c2c(C)c(C)c(-c3cnc4nccnc4n3)c(C)c2C)c(C)c(C)c1-c1cnc2nccnc2n1 |
| InChI | InChI=1S/C42H37N9/c1-22-26(5)37(27(6)23(2)35(22)33-20-47-39-41(49-33)45-17-15-43-39)51(32-14-13-30-11-9-10-12-31(30)19-32)38-28(7)24(3)36(25(4)29(38)8)34-21-48-40-42(50-34)46-18-16-44-40/h9-21H,1-8H3 |
| InChIKey | SMXLIVMIVQBEDT-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |