C46H27N7S2 — CID 170404974
7-naphthalen-2-yl-N,N-bis[4-([1,3]thiazolo[4,5-b]pyrazin-2-yl)phenyl]phenanthren-2-amine (PubChem CID 170404974) has the molecular formula C46H27N7S2 and a molecular weight of 741.91 g/mol. Its IUPAC name is 7-naphthalen-2-yl-N,N-bis[4-([1,3]thiazolo[4,5-b]pyrazin-2-yl)phenyl]phenanthren-2-amine.
| Compound Name | 7-naphthalen-2-yl-N,N-bis[4-([1,3]thiazolo[4,5-b]pyrazin-2-yl)phenyl]phenanthren-2-amine |
|---|---|
| PubChem CID | 170404974 |
| Molecular Formula | C46H27N7S2 |
| Molecular Weight | 741.91 g/mol |
| Exact Mass | 741.18 |
| IUPAC Name | 7-naphthalen-2-yl-N,N-bis[4-([1,3]thiazolo[4,5-b]pyrazin-2-yl)phenyl]phenanthren-2-amine |
| SMILES | c1ccc2cc(-c3ccc4c(ccc5cc(N(c6ccc(-c7nc8nccnc8s7)cc6)c6ccc(-c7nc8nccnc8s7)cc6)ccc54)c3)ccc2c1 |
| InChI | InChI=1S/C46H27N7S2/c1-2-4-31-25-32(6-5-28(31)3-1)33-13-19-39-34(26-33)7-8-35-27-38(18-20-40(35)39)53(36-14-9-29(10-15-36)43-51-41-45(54-43)49-23-21-47-41)37-16-11-30(12-17-37)44-52-42-46(55-44)50-24-22-48-42/h1-27H |
| InChIKey | SOAAWRRVVHUMLC-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.91 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|