C29H46O — CID 130355001
4,10,13-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 130355001) has the molecular formula C29H46O and a molecular weight of 410.69 g/mol. Its IUPAC name is 4,10,13-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 4,10,13-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 130355001 |
| Molecular Formula | C29H46O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.35 |
| IUPAC Name | 4,10,13-trimethyl-17-(6-methyl-5-methylideneheptan-2-yl)-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(CCC(C)C1CC=C2C3=CCC4C(C)C(O)CCC4(C)C3CCC21C)C(C)C |
| InChI | InChI=1S/C29H46O/c1-18(2)19(3)8-9-20(4)23-12-13-25-22-10-11-24-21(5)27(30)15-17-29(24,7)26(22)14-16-28(23,25)6/h10,13,18,20-21,23-24,26-27,30H,3,8-9,11-12,14-17H2,1-2,4-7H3 |
| InChIKey | TWOQTEWSRODDAA-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|