C32H54O — CID 162818514
4,10,13,14,15-pentamethyl-17-(5-propan-2-ylhept-5-en-2-yl)-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 162818514) has the molecular formula C32H54O and a molecular weight of 454.78 g/mol. Its IUPAC name is 4,10,13,14,15-pentamethyl-17-(5-propan-2-ylhept-5-en-2-yl)-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 4,10,13,14,15-pentamethyl-17-(5-propan-2-ylhept-5-en-2-yl)-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 162818514 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | 4,10,13,14,15-pentamethyl-17-(5-propan-2-ylhept-5-en-2-yl)-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC=C(CCC(C)C1CC(C)C2(C)C3=CCC4C(C)C(O)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C32H54O/c1-10-24(20(2)3)12-11-21(4)28-19-22(5)32(9)27-14-13-25-23(6)29(33)16-17-30(25,7)26(27)15-18-31(28,32)8/h10,14,20-23,25-26,28-29,33H,11-13,15-19H2,1-9H3 |
| InChIKey | MHNJBCPXLRYFRC-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|