C28H19N2O2P — CID 130355946
10-phenyl-2-(6-pyridin-3-yl-2-pyridinyl)phenoxaphosphinine 10-oxide (PubChem CID 130355946) has the molecular formula C28H19N2O2P and a molecular weight of 446.45 g/mol. Its IUPAC name is 10-phenyl-2-(6-pyridin-3-yl-2-pyridinyl)phenoxaphosphinine 10-oxide.
| Compound Name | 10-phenyl-2-(6-pyridin-3-yl-2-pyridinyl)phenoxaphosphinine 10-oxide |
|---|---|
| PubChem CID | 130355946 |
| Molecular Formula | C28H19N2O2P |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 10-phenyl-2-(6-pyridin-3-yl-2-pyridinyl)phenoxaphosphinine 10-oxide |
| SMILES | O=P1(c2ccccc2)c2ccccc2Oc2ccc(-c3cccc(-c4cccnc4)n3)cc21 |
| InChI | InChI=1S/C28H19N2O2P/c31-33(22-9-2-1-3-10-22)27-14-5-4-13-25(27)32-26-16-15-20(18-28(26)33)23-11-6-12-24(30-23)21-8-7-17-29-19-21/h1-19H |
| InChIKey | BZVFZTOTXUMNQD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|