C38H28NO2P — CID 130356002
2-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)-10-phenylphenoxaphosphinine 10-oxide (PubChem CID 130356002) has the molecular formula C38H28NO2P and a molecular weight of 561.62 g/mol. Its IUPAC name is 2-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)-10-phenylphenoxaphosphinine 10-oxide.
| Compound Name | 2-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)-10-phenylphenoxaphosphinine 10-oxide |
|---|---|
| PubChem CID | 130356002 |
| Molecular Formula | C38H28NO2P |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 2-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)-10-phenylphenoxaphosphinine 10-oxide |
| SMILES | CC1(C)c2cc(-c3cccnc3)ccc2-c2ccc(-c3ccc4c(c3)P(=O)(c3ccccc3)c3ccccc3O4)cc21 |
| InChI | InChI=1S/C38H28NO2P/c1-38(2)32-21-25(14-17-30(32)31-18-15-26(22-33(31)38)28-9-8-20-39-24-28)27-16-19-35-37(23-27)42(40,29-10-4-3-5-11-29)36-13-7-6-12-34(36)41-35/h3-24H,1-2H3 |
| InChIKey | ZPJCQQWWOICINJ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|