C32H25NO2S — CID 121296805
3-[6-[3-(benzenesulfinyl)phenyl]-9,9-dimethylxanthen-3-yl]pyridine (PubChem CID 121296805) has the molecular formula C32H25NO2S and a molecular weight of 487.62 g/mol. Its IUPAC name is 3-[6-[3-(benzenesulfinyl)phenyl]-9,9-dimethylxanthen-3-yl]pyridine.
| Compound Name | 3-[6-[3-(benzenesulfinyl)phenyl]-9,9-dimethylxanthen-3-yl]pyridine |
|---|---|
| PubChem CID | 121296805 |
| Molecular Formula | C32H25NO2S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 3-[6-[3-(benzenesulfinyl)phenyl]-9,9-dimethylxanthen-3-yl]pyridine |
| SMILES | CC1(C)c2ccc(-c3cccnc3)cc2Oc2cc(-c3cccc(S(=O)c4ccccc4)c3)ccc21 |
| InChI | InChI=1S/C32H25NO2S/c1-32(2)28-15-13-23(22-8-6-12-27(18-22)36(34)26-10-4-3-5-11-26)19-30(28)35-31-20-24(14-16-29(31)32)25-9-7-17-33-21-25/h3-21H,1-2H3 |
| InChIKey | LFUXQNGOJLLKJX-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |