About 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine
4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine (PubChem CID 169262127) has the molecular formula C25H19ClN2
and a molecular weight of 382.89 g/mol. Its IUPAC name is 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine.
Molecular Properties
| Compound Name | 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine |
| PubChem CID | 169262127 |
| Molecular Formula | C25H19ClN2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine |
| SMILES | CC1(C)c2ccc(-c3cccnc3)cc2-c2cc(-c3cnccc3Cl)ccc21 |
| InChI | InChI=1S/C25H19ClN2/c1-25(2)22-7-5-16(18-4-3-10-27-14-18)12-19(22)20-13-17(6-8-23(20)25)21-15-28-11-9-24(21)26/h3-15H,1-2H3 |
| InChIKey | DWIQMQQWOLEYLZ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine?
The IUPAC name of 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine (CID 169262127) is 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine.
What is the SMILES notation for 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine?
The canonical SMILES for 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine is CC1(C)c2ccc(-c3cccnc3)cc2-c2cc(-c3cnccc3Cl)ccc21.
What is the InChIKey of 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine?
The InChIKey is DWIQMQQWOLEYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClN2/c1-25(2)22-7-5-16(18-4-3-10-27-14-18)12-19(22)20-13-17(6-8-23(20)25)21-15-28-11-9-24(21)26/h3-15H,1-2H3.
What are the key properties of 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine?
4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine has a molecular weight of 382.89 g/mol, XLogP of 6.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(9,9-dimethyl-6-pyridin-3-ylfluoren-3-yl)pyridine is sourced from PubChem (CID 169262127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).