C23H36O3S — CID 130358756
(2S,3S,5S,8S,9S,10S,13S,14S,17Z)-2-ethoxy-17-ethylidene-10,13-dimethyl-3-sulfanyloxy-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 130358756) has the molecular formula C23H36O3S and a molecular weight of 392.61 g/mol. Its IUPAC name is (2S,3S,5S,8S,9S,10S,13S,14S,17Z)-2-ethoxy-17-ethylidene-10,13-dimethyl-3-sulfanyloxy-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (2S,3S,5S,8S,9S,10S,13S,14S,17Z)-2-ethoxy-17-ethylidene-10,13-dimethyl-3-sulfanyloxy-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 130358756 |
| Molecular Formula | C23H36O3S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (2S,3S,5S,8S,9S,10S,13S,14S,17Z)-2-ethoxy-17-ethylidene-10,13-dimethyl-3-sulfanyloxy-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | C/C=C1/CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OS)[C@@H](OCC)C[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C23H36O3S/c1-5-14-8-10-17-16-9-7-15-11-19(26-27)20(25-6-2)13-23(15,4)21(16)18(24)12-22(14,17)3/h5,15-17,19-21,27H,6-13H2,1-4H3/b14-5-/t15-,16-,17-,19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | KCQRYUIJPQPUFW-VISUTAANSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|