C23H39NO2 — CID 12796479
(2S,3S,5S,8S,9S,10S,11R,13S,14S,17Z)-11-amino-2-ethoxy-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 12796479) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is (2S,3S,5S,8S,9S,10S,11R,13S,14S,17Z)-11-amino-2-ethoxy-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (2S,3S,5S,8S,9S,10S,11R,13S,14S,17Z)-11-amino-2-ethoxy-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 12796479 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | (2S,3S,5S,8S,9S,10S,11R,13S,14S,17Z)-11-amino-2-ethoxy-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C/C=C1/CC[C@H]2[C@@H]3CC[C@H]4C[C@H](O)[C@@H](OCC)C[C@]4(C)[C@H]3[C@H](N)C[C@]12C |
| InChI | InChI=1S/C23H39NO2/c1-5-14-8-10-17-16-9-7-15-11-19(25)20(26-6-2)13-23(15,4)21(16)18(24)12-22(14,17)3/h5,15-21,25H,6-13,24H2,1-4H3/b14-5-/t15-,16-,17-,18+,19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | WZQFNABSIJKKCD-MYJJNKTCSA-N |
| XLogP | 4.29 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|