C16H29O6P — CID 130359524
ethyl (3R)-3-hydroxy-4-[(2R,6S)-6-[(2S)-4-hydroxy-2-phosphanyloxybutyl]-4-methylideneoxan-2-yl]butanoate (PubChem CID 130359524) has the molecular formula C16H29O6P and a molecular weight of 348.38 g/mol. Its IUPAC name is ethyl (3R)-3-hydroxy-4-[(2R,6S)-6-[(2S)-4-hydroxy-2-phosphanyloxybutyl]-4-methylideneoxan-2-yl]butanoate.
| Compound Name | ethyl (3R)-3-hydroxy-4-[(2R,6S)-6-[(2S)-4-hydroxy-2-phosphanyloxybutyl]-4-methylideneoxan-2-yl]butanoate |
|---|---|
| PubChem CID | 130359524 |
| Molecular Formula | C16H29O6P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | ethyl (3R)-3-hydroxy-4-[(2R,6S)-6-[(2S)-4-hydroxy-2-phosphanyloxybutyl]-4-methylideneoxan-2-yl]butanoate |
| SMILES | C=C1C[C@H](C[C@@H](O)CC(=O)OCC)O[C@H](C[C@H](CCO)OP)C1 |
| InChI | InChI=1S/C16H29O6P/c1-3-20-16(19)9-12(18)8-14-6-11(2)7-15(21-14)10-13(22-23)4-5-17/h12-15,17-18H,2-10,23H2,1H3/t12-,13+,14-,15+/m1/s1 |
| InChIKey | VYIVXBJKLQNQIU-BARDWOONSA-N |
| XLogP | 1.74 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|