C29H40O10 — CID 130359884
methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R,3R)-2-hydroxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate (PubChem CID 130359884) has the molecular formula C29H40O10 and a molecular weight of 548.63 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R,3R)-2-hydroxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R,3R)-2-hydroxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 130359884 |
| Molecular Formula | C29H40O10 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R,3R)-2-hydroxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1\C[C@@H](C[C@@H](O)[C@@H](C)OCOCc2ccccc2)O[C@@](OC)(C(C)(C)/C=C/C=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C29H40O10/c1-20(37-19-36-18-22-11-8-7-9-12-22)25(32)17-24-15-23(16-26(33)34-5)27(38-21(2)31)29(35-6,39-24)28(3,4)13-10-14-30/h7-14,16,20,24-25,27,32H,15,17-19H2,1-6H3/b13-10+,23-16+/t20-,24+,25-,27+,29-/m1/s1 |
| InChIKey | QLSQUROJQVXJQJ-YPYMOOTESA-N |
| XLogP | 3.26 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|