C34H50O9 — CID 89316812
[(2S,3S,4E)-6-[(2R,3R)-2-hydroxy-3-phenylmethoxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate (PubChem CID 89316812) has the molecular formula C34H50O9 and a molecular weight of 602.77 g/mol. Its IUPAC name is [(2S,3S,4E)-6-[(2R,3R)-2-hydroxy-3-phenylmethoxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E)-6-[(2R,3R)-2-hydroxy-3-phenylmethoxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 89316812 |
| Molecular Formula | C34H50O9 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | [(2S,3S,4E)-6-[(2R,3R)-2-hydroxy-3-phenylmethoxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)CC(C[C@@H](O)[C@@H](C)OCc2ccccc2)O[C@@]1(OC)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C34H50O9/c1-7-8-9-10-14-18-30(37)42-32-27(22-31(38)39-5)21-28(43-34(32,40-6)33(3,4)19-15-20-35)23-29(36)25(2)41-24-26-16-12-11-13-17-26/h11-13,15-17,19-20,22,25,28-29,32,36H,7-10,14,18,21,23-24H2,1-6H3/b19-15+,27-22+/t25-,28?,29-,32+,34-/m1/s1 |
| InChIKey | CYNMHVHGXZKBKI-HEIASXSRSA-N |
| XLogP | 5.63 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|