C31H54O9Si — CID 57327162
[(2S,3S,4E,6S)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate (PubChem CID 57327162) has the molecular formula C31H54O9Si and a molecular weight of 598.85 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6S)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 57327162 |
| Molecular Formula | C31H54O9Si |
| Molecular Weight | 598.85 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | [(2S,3S,4E,6S)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](C[C@H](O)CO[Si](C)(C)C(C)(C)C)O[C@@]1(O)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C31H54O9Si/c1-10-11-12-13-14-16-26(34)39-28-23(20-27(35)37-7)19-25(40-31(28,36)30(5,6)17-15-18-32)21-24(33)22-38-41(8,9)29(2,3)4/h15,17-18,20,24-25,28,33,36H,10-14,16,19,21-22H2,1-9H3/b17-15+,23-20+/t24-,25-,28-,31+/m0/s1 |
| InChIKey | CURAVHLLYHUBGG-RQPPNRQDSA-N |
| XLogP | 5.39 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.85 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|