C24H40BO7S — CID 58932795
CID 58932795 (PubChem CID 58932795) has the molecular formula C24H40BO7S and a molecular weight of 485.46 g/mol.
| Compound Name | CID 58932795 |
|---|---|
| PubChem CID | 58932795 |
| Molecular Formula | C24H40BO7S |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | — |
| SMILES | [3H][B]SOCC(C)(C)[C@]1(OC)O[C@H](CC=C)C/C(=C\C(=O)OC)[C@@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C24H40BO7S/c1-7-9-10-11-12-14-20(26)31-22-18(16-21(27)28-5)15-19(13-8-2)32-24(22,29-6)23(3,4)17-30-33-25/h8,16,19,22,25H,2,7,9-15,17H2,1,3-6H3/b18-16+/t19-,22+,24-/m1/s1/i25T |
| InChIKey | APYOWHPFZVWGSB-HNJVBDJRSA-N |
| XLogP | 4.57 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|