About CID 160973660
CID 160973660 (PubChem CID 160973660) has the molecular formula C32H50B2O13S2
and a molecular weight of 732.51 g/mol.
Molecular Properties
| Compound Name | CID 160973660 |
| PubChem CID | 160973660 |
| Molecular Formula | C32H50B2O13S2 |
| Molecular Weight | 732.51 g/mol |
| Exact Mass | 732.30 |
| IUPAC Name | — |
| SMILES | COC(=O)C=O.[3H][B]SOCC(C)(C)[C@]1(OC)O[C@H](CC=C)C/C(=C\C(=O)OC)C1=O.[3H][B]SOCC(C)(C)[C@]1(OC)O[C@H](CC=C)CCC1=O |
| InChI | InChI=1S/C16H24BO6S.C13H22BO4S.C3H4O3/c1-6-7-12-8-11(9-13(18)20-4)14(19)16(21-5,23-12)15(2,3)10-22-24-17;1-5-6-10-7-8-11(15)13(16-4,18-10)12(2,3)9-17-19-14;1-6-3(5)2-4/h6,9,12,17H,1,7-8,10H2,2-5H3;5,10,14H,1,6-9H2,2-4H3;2H,1H3/b11-9+;;/t12-,16-;10-,13-;/m11./s1/i17T;14T; |
| InChIKey | OKTISEYJFBZIDM-IBUZFOIVSA-N |
| XLogP | 3.39 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 732.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 160973660 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160973660?
The IUPAC name of CID 160973660 (CID 160973660) is not available.
What is the SMILES notation for CID 160973660?
The canonical SMILES for CID 160973660 is COC(=O)C=O.[3H][B]SOCC(C)(C)[C@]1(OC)O[C@H](CC=C)C/C(=C\C(=O)OC)C1=O.[3H][B]SOCC(C)(C)[C@]1(OC)O[C@H](CC=C)CCC1=O.
What is the InChIKey of CID 160973660?
The InChIKey is OKTISEYJFBZIDM-IBUZFOIVSA-N. The full InChI is InChI=1S/C16H24BO6S.C13H22BO4S.C3H4O3/c1-6-7-12-8-11(9-13(18)20-4)14(19)16(21-5,23-12)15(2,3)10-22-24-17;1-5-6-10-7-8-11(15)13(16-4,18-10)12(2,3)9-17-19-14;1-6-3(5)2-4/h6,9,12,17H,1,7-8,10H2,2-5H3;5,10,14H,1,6-9H2,2-4H3;2H,1H3/b11-9+;;/t12-,16-;10-,13-;/m11./s1/i17T;14T;.
What are the key properties of CID 160973660?
CID 160973660 has a molecular weight of 732.51 g/mol, XLogP of 3.39, 18 rotatable bonds, 0 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160973660 is sourced from PubChem (CID 160973660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).