C32H50B2O13S2 — CID 160973660
CID 160973660 (PubChem CID 160973660) has the molecular formula C32H50B2O13S2 and a molecular weight of 732.51 g/mol.
| Compound Name | CID 160973660 |
|---|---|
| PubChem CID | 160973660 |
| Molecular Formula | C32H50B2O13S2 |
| Molecular Weight | 732.51 g/mol |
| Exact Mass | 732.30 |
| IUPAC Name | — |
| SMILES | COC(=O)C=O.[3H][B]SOCC(C)(C)[C@]1(OC)O[C@H](CC=C)C/C(=C\C(=O)OC)C1=O.[3H][B]SOCC(C)(C)[C@]1(OC)O[C@H](CC=C)CCC1=O |
| InChI | InChI=1S/C16H24BO6S.C13H22BO4S.C3H4O3/c1-6-7-12-8-11(9-13(18)20-4)14(19)16(21-5,23-12)15(2,3)10-22-24-17;1-5-6-10-7-8-11(15)13(16-4,18-10)12(2,3)9-17-19-14;1-6-3(5)2-4/h6,9,12,17H,1,7-8,10H2,2-5H3;5,10,14H,1,6-9H2,2-4H3;2H,1H3/b11-9+;;/t12-,16-;10-,13-;/m11./s1/i17T;14T; |
| InChIKey | OKTISEYJFBZIDM-IBUZFOIVSA-N |
| XLogP | 3.39 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|