C23H40BO4S — CID 59116808
CID 59116808 (PubChem CID 59116808) has the molecular formula C23H40BO4S and a molecular weight of 425.46 g/mol.
| Compound Name | CID 59116808 |
|---|---|
| PubChem CID | 59116808 |
| Molecular Formula | C23H40BO4S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | — |
| SMILES | [3H][B]SOCC(C)(C)[C@]1(C)O[C@H](CC=C)C/C(=C\C)[C@@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C23H40BO4S/c1-7-10-11-12-13-15-20(25)27-21-18(9-3)16-19(14-8-2)28-23(21,6)22(4,5)17-26-29-24/h8-9,19,21,24H,2,7,10-17H2,1,3-6H3/b18-9+/t19-,21+,23-/m1/s1/i24T |
| InChIKey | IBZPSQGVUIPQLS-ANCKQLJDSA-N |
| XLogP | 5.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|