C29H50BO4P — CID 59116834
CID 59116834 (PubChem CID 59116834) has the molecular formula C29H50BO4P and a molecular weight of 504.50 g/mol.
| Compound Name | CID 59116834 |
|---|---|
| PubChem CID | 59116834 |
| Molecular Formula | C29H50BO4P |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | — |
| SMILES | [B]P(C)OC(C[C@@H]1C/C(=C\C)[C@H](OC(=O)CCCCC=C)[C@](C)(C(C)(C)/C=C/C(C)C)O1)C(C)C |
| InChI | InChI=1S/C29H50BO4P/c1-11-13-14-15-16-26(31)32-27-23(12-2)19-24(20-25(22(5)6)34-35(10)30)33-29(27,9)28(7,8)18-17-21(3)4/h11-12,17-18,21-22,24-25,27H,1,13-16,19-20H2,2-10H3/b18-17+,23-12+/t24-,25?,27-,29+,35?/m0/s1 |
| InChIKey | GHSNWMUEUBCXIM-HHJOZNLGSA-N |
| XLogP | 7.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|