C17H24O5 — CID 102412065
[(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] hept-6-enoate (PubChem CID 102412065) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] hept-6-enoate.
| Compound Name | [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] hept-6-enoate |
|---|---|
| PubChem CID | 102412065 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C=C)O[C@@H]1C=C |
| InChI | InChI=1S/C17H24O5/c1-5-8-9-10-11-15(19)22-17-14(7-3)21-13(6-2)16(17)20-12(4)18/h5-7,13-14,16-17H,1-3,8-11H2,4H3/t13-,14+,16+,17-/m0/s1 |
| InChIKey | IRMNIYZGKXHOSU-ABFRBSLYSA-N |
| XLogP | 2.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|