C14H16O5 — CID 102412067
[(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate (PubChem CID 102412067) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate.
| Compound Name | [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate |
|---|---|
| PubChem CID | 102412067 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate |
| SMILES | C=C[C@@H]1O[C@H](C=C)[C@H](OC(=O)C#CC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H16O5/c1-5-8-12(16)19-14-11(7-3)18-10(6-2)13(14)17-9(4)15/h6-7,10-11,13-14H,2-3H2,1,4H3/t10-,11+,13+,14-/m0/s1 |
| InChIKey | AFFCHHYKFZZZQP-UNJBNNCHSA-N |
| XLogP | 0.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|