C30H48O7SSi — CID 87214112
(E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioic S-acid (PubChem CID 87214112) has the molecular formula C30H48O7SSi and a molecular weight of 580.86 g/mol. Its IUPAC name is (E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioic S-acid.
| Compound Name | (E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioic S-acid |
|---|---|
| PubChem CID | 87214112 |
| Molecular Formula | C30H48O7SSi |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | (E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioic S-acid |
| SMILES | CO[C@@]1(C(C)(C)/C=C/C(=O)S)O[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)OCOCc2ccccc2)CCC1=O |
| InChI | InChI=1S/C30H48O7SSi/c1-22(35-21-34-20-23-13-11-10-12-14-23)25(37-39(8,9)28(2,3)4)19-24-15-16-26(31)30(33-7,36-24)29(5,6)18-17-27(32)38/h10-14,17-18,22,24-25H,15-16,19-21H2,1-9H3,(H,32,38)/b18-17+/t22-,24+,25-,30-/m1/s1 |
| InChIKey | YTIWISNAAHMUOM-KKLPVEJRSA-N |
| XLogP | 6.48 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|