C32H42O6 — CID 118281040
(E)-5-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-5-methylhex-3-en-2-one (PubChem CID 118281040) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is (E)-5-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-5-methylhex-3-en-2-one.
| Compound Name | (E)-5-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-5-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 118281040 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (E)-5-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-5-methylhex-3-en-2-one |
| SMILES | COc1ccc(CO[C@H](C[C@@H]2CCC=C(C(C)(C)/C=C/C(C)=O)O2)[C@@H](C)OCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H42O6/c1-24(33)18-19-32(3,4)31-13-9-12-29(38-31)20-30(36-22-27-14-16-28(34-5)17-15-27)25(2)37-23-35-21-26-10-7-6-8-11-26/h6-8,10-11,13-19,25,29-30H,9,12,20-23H2,1-5H3/b19-18+/t25-,29+,30-/m1/s1 |
| InChIKey | MJQPNOIDOIKWIG-PJBLFSKFSA-N |
| XLogP | 6.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|