C15H20F3N3O3 — CID 130359931
4-(3-methylmorpholin-4-yl)-6-[3-(trifluoromethyl)morpholin-4-yl]-1H-pyridin-2-one (PubChem CID 130359931) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is 4-(3-methylmorpholin-4-yl)-6-[3-(trifluoromethyl)morpholin-4-yl]-1H-pyridin-2-one.
| Compound Name | 4-(3-methylmorpholin-4-yl)-6-[3-(trifluoromethyl)morpholin-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130359931 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-(3-methylmorpholin-4-yl)-6-[3-(trifluoromethyl)morpholin-4-yl]-1H-pyridin-2-one |
| SMILES | CC1COCCN1c1cc(N2CCOCC2C(F)(F)F)[nH]c(=O)c1 |
| InChI | InChI=1S/C15H20F3N3O3/c1-10-8-23-4-2-20(10)11-6-13(19-14(22)7-11)21-3-5-24-9-12(21)15(16,17)18/h6-7,10,12H,2-5,8-9H2,1H3,(H,19,22) |
| InChIKey | HMQUAFQWSSAWFO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |