C17H27F3N5O4S- — CID 175027135
CID 175027135 (PubChem CID 175027135) has the molecular formula C17H27F3N5O4S- and a molecular weight of 454.50 g/mol.
| Compound Name | CID 175027135 |
|---|---|
| PubChem CID | 175027135 |
| Molecular Formula | C17H27F3N5O4S- |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | — |
| SMILES | CC1C(C(F)(F)F)N(c2cc(N3CCOCC3C)cc(=O)[nH]2)CCN1C.NS(=O)[O-] |
| InChI | InChI=1S/C17H25F3N4O2.H3NO2S/c1-11-10-26-7-6-23(11)13-8-14(21-15(25)9-13)24-5-4-22(3)12(2)16(24)17(18,19)20;1-4(2)3/h8-9,11-12,16H,4-7,10H2,1-3H3,(H,21,25);1H2,(H,2,3)/p-1 |
| InChIKey | GWNLVNDJBZKOAB-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|