C7H8FN — CID 130360998
N-[(2E)-4-fluoropenta-2,4-dien-2-yl]ethenimine (PubChem CID 130360998) has the molecular formula C7H8FN and a molecular weight of 125.15 g/mol. Its IUPAC name is N-[(2E)-4-fluoropenta-2,4-dien-2-yl]ethenimine.
| Compound Name | N-[(2E)-4-fluoropenta-2,4-dien-2-yl]ethenimine |
|---|---|
| PubChem CID | 130360998 |
| Molecular Formula | C7H8FN |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | N-[(2E)-4-fluoropenta-2,4-dien-2-yl]ethenimine |
| SMILES | C=C=N/C(C)=C/C(=C)F |
| InChI | InChI=1S/C7H8FN/c1-4-9-7(3)5-6(2)8/h5H,1-2H2,3H3/b7-5+ |
| InChIKey | KBNIWXVOFOWYOC-FNORWQNLSA-N |
| XLogP | 2.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|