C8H14FN — CID 176684239
ethane;N-[(2Z,4E)-5-fluoropenta-2,4-dien-2-yl]methanimine (PubChem CID 176684239) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is ethane;N-[(2Z,4E)-5-fluoropenta-2,4-dien-2-yl]methanimine.
| Compound Name | ethane;N-[(2Z,4E)-5-fluoropenta-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 176684239 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | ethane;N-[(2Z,4E)-5-fluoropenta-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(C)=C\C=C\F.CC |
| InChI | InChI=1S/C6H8FN.C2H6/c1-6(8-2)4-3-5-7;1-2/h3-5H,2H2,1H3;1-2H3/b5-3+,6-4-; |
| InChIKey | ZFKDANNHQQQHJE-LGCFFMJUSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|